CAS 112822-85-2
:2,4,5-Trifluoro-3-methylbenzoic acid
Description:
2,4,5-Trifluoro-3-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of three fluorine atoms and a methyl group attached to a benzoic acid framework. The trifluoromethyl groups are located at the 2, 4, and 5 positions relative to the carboxylic acid functional group, which significantly influences the compound's chemical properties, including its acidity and reactivity. This compound is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid group. The trifluoromethyl substituents enhance the compound's lipophilicity and can affect its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the presence of fluorine atoms can impart unique electronic properties, influencing the compound's behavior in chemical reactions. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks.
Formula:C8H5F3O2
InChI:InChI=1/C8H5F3O2/c1-3-6(10)4(8(12)13)2-5(9)7(3)11/h2H,1H3,(H,12,13)
SMILES:Cc1c(c(cc(c1F)F)C(=O)O)F
Synonyms:- 3-Methyl-2,4,5-Trifluorobenzoic Acid
- 2,4,5-Trifluoro-3-Methyl Benzoic Acid
- 3-Methyl-2,4,5-TrifluorobenzoicAcid99%
- 3-Methyl-2,4,5-Trifluorobenzoic Acid 99%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4,5-Trifluoro-3-methylbenzoic acid
CAS:Formula:C8H5F3O2Purity:97%Color and Shape:SolidMolecular weight:190.11933-Methyl-2,4,5-trifluorobenzoic acid
CAS:3-Methyl-2,4,5-trifluorobenzoic acidPurity:97%Molecular weight:190.12g/mol3-Methyl-2,4,5-trifluorobenzoic acid
CAS:<p>3-Methyl-2,4,5-trifluorobenzoic acid is a fluoroquinolone antibiotic that inhibits the DNA gyrase and topoisomerase IV. It binds to bacterial 16S ribosomal RNA and inhibits protein synthesis, leading to cell death by inhibiting the production of proteins vital for cell division. 3-Methyl-2,4,5-trifluorobenzoic acid has been shown to be bactericidal in vitro against Gram-negative bacteria such as Escherichia coli and Pseudomonas aeruginosa. This drug also has a target enzyme modification activity with the potential to modify enzymes not usually targeted by fluoroquinolones.</p>Formula:C8H5F3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:190.12 g/mol2,4,5-Trifluoro-3-methylbenzoic acid
CAS:Formula:C8H5F3O2Purity:97%Color and Shape:SolidMolecular weight:190.121



