CAS 112844-43-6

Pseudourea, 2-(cyclohexylmethyl)-2-thio-, hydrobromide

Description:

Pseudourea, 2-(cyclohexylmethyl)-2-thio-, hydrobromide is a chemical compound characterized by its unique structure, which includes a pseudourea functional group and a cyclohexylmethyl substituent. The presence of the thio group (sulfur) in its structure imparts distinct chemical properties, such as potential reactivity with electrophiles and the ability to form various derivatives. As a hydrobromide salt, it is typically more soluble in polar solvents, which can enhance its utility in various applications, including medicinal chemistry and organic synthesis. The compound may exhibit biological activity, making it of interest in pharmacological research. Its molecular interactions, stability, and reactivity can be influenced by the cyclohexyl group, which may affect its conformational flexibility and steric hindrance. Overall, this compound represents a class of thio-substituted pseudoureas that could have potential applications in drug development or as intermediates in synthetic chemistry. However, specific safety and handling guidelines should be followed due to the potential hazards associated with its chemical properties.

Formula: C₈H₁₆N₂S·BrH

InChI: InChI=1S/C8H16N2S.BrH/c9-8(10)11-6-7-4-2-1-3-5-7;/h7H,1-6H2,(H3,9,10);1H

InChI key: InChIKey=UNEBLEPWVZWLRY-UHFFFAOYSA-N

SMILES: C(SC(=N)N)C1CCCCC1.Br

Synonyms:

• [(Cyclohexylmethyl)sulfanyl]methanimidamide hydrobromide
• Pseudourea, 2-(cyclohexylmethyl)-2-thio-, hydrobromide

[(cyclohexylmethyl)sulfanyl]methanimidamide hydrobromide

CAS: 112844-43-6

Formula: C₈H₁₇BrN₂S

Purity: 95.0%

Molecular weight: 253.2

Ref: 10-F525843