CAS 112857-68-8
:2,4-Difluoro-3-methylbenzoic acid
Description:
2,4-Difluoro-3-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methyl group on a benzoic acid framework. The fluorine substituents are located at the 2 and 4 positions, while the methyl group is at the 3 position, contributing to its unique chemical properties. This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its fluorine atoms enhance the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound's molecular structure can lead to interesting interactions in biological systems, potentially affecting its reactivity and stability. Overall, 2,4-Difluoro-3-methylbenzoic acid is a versatile compound with applications in various fields, including medicinal chemistry and materials science.
Formula:C8H6F2O2
InChI:InChI=1/C8H6F2O2/c1-4-6(9)3-2-5(7(4)10)8(11)12/h2-3H,1H3,(H,11,12)
SMILES:Cc1c(ccc(c1F)C(=O)O)F
Synonyms:- Benzoic acid, 2,4-difluoro-3-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Difluoro-3-methylbenzoic acid
CAS:Formula:C8H6F2O2Purity:95%Color and Shape:SolidMolecular weight:172.12882,4-Difluoro-3-methylbenzoic acid
CAS:2,4-Difluoro-3-methylbenzoic acidPurity:95%Molecular weight:172.13g/mol2,4-Difluoro-3-methylbenzoic acid
CAS:Formula:C8H6F2O2Purity:≥95%Color and Shape:SolidMolecular weight:172.1312,4-difluoro-3-methylbenzoic Acid
CAS:Please enquire for more information about 2,4-difluoro-3-methylbenzoic Acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C8H6F2O2Purity:Min. 95%Molecular weight:172.13 g/mol



