CymitQuimica logo

CAS 112883-41-7

:

fmoc-D-norleucine

Description:
Fmoc-D-norleucine, with the CAS number 112883-41-7, is a derivative of the amino acid norleucine, which is an analog of leucine. The "Fmoc" (9-fluorenylmethoxycarbonyl) group is a common protective group used in peptide synthesis, allowing for the selective protection of the amino group during the coupling reactions. This compound is characterized by its ability to participate in peptide bond formation, making it valuable in the synthesis of peptides and proteins. Fmoc-D-norleucine is typically a white to off-white solid and is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. Its structure includes a chiral center, which contributes to its stereochemical properties, making it important in the design of biologically active peptides. The presence of the Fmoc group facilitates the removal of the protecting group under mild basic conditions, allowing for further functionalization or incorporation into larger peptide sequences. Overall, Fmoc-D-norleucine is a crucial building block in the field of peptide chemistry.
Formula:C21H23NO4
InChI:InChI=1/C21H23NO4/c1-2-3-12-19(20(23)24)22-21(25)26-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,2-3,12-13H2,1H3,(H,22,25)(H,23,24)/t19-/m1/s1
InChI key:VCFCFPNRQDANPN-LJQANCHMSA-N
SMILES:CCCC[C@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:
  • Fmoc-D-Nle-OH
  • N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-norleucine
Found 7 products.