CAS 112885-41-3: Mosapride
Description:Mosapride is a gastroprokinetic agent primarily used to treat gastrointestinal disorders, particularly functional dyspepsia and gastroesophageal reflux disease (GERD). It acts as a selective serotonin 5-HT4 receptor agonist, enhancing gastrointestinal motility by increasing the release of acetylcholine in the enteric nervous system. This mechanism promotes gastric emptying and improves symptoms related to delayed gastric transit. Mosapride is characterized by its relatively low solubility in water, which can influence its bioavailability and absorption. The compound is typically administered orally and is known for its favorable safety profile, with fewer side effects compared to other prokinetic agents. Its chemical structure includes a piperidine ring, contributing to its pharmacological properties. Mosapride is often well-tolerated, making it a preferred choice in clinical settings for managing digestive disorders. As with any medication, it is essential to consider potential interactions and contraindications when prescribing or using Mosapride.
Formula:C21H25ClFN3O3
InChI:InChI=1S/C21H25ClFN3O3/c1-2-28-20-10-19(24)18(22)9-17(20)21(27)25-11-16-13-26(7-8-29-16)12-14-3-5-15(23)6-4-14/h3-6,9-10,16H,2,7-8,11-13,24H2,1H3,(H,25,27)
InChI key:InChIKey=YPELFRMCRYSPKZ-UHFFFAOYSA-N
SMILES:O=C(NCC1OCCN(CC2=CC=C(F)C=C2)C1)C=3C=C(Cl)C(N)=CC3OCC
- Synonyms:
- (±)-4-Amino-5-chloro-2-ethoxy-N-[[4-(4-fluorobenzyl)-2-morpholinyl]methyl]benzamide
- 112885-41-3
- 4-Amino-5-chloro-2-ethoxy-N-[[4-[(4-fluorophenyl)methyl]-2-morpholinyl]methyl]benzamide
- 4-amino-5-chloro-2-ethoxy-N-{[4-(4-fluorobenzyl)morpholin-2-yl]methyl}benzamide
- benzamide, 4-amino-5-chloro-2-ethoxy-N-[[4-[(4-fluorophenyl)methyl]-2-morpholinyl]methyl]-
- Mosapride
- Moza
