CAS 112888-43-4

6-Bromomethyl-3,4-dihydro-2-methyl-quinazolin-4-one

Description:

6-Bromomethyl-3,4-dihydro-2-methyl-quinazolin-4-one is a chemical compound characterized by its quinazolinone structure, which features a fused bicyclic system. This compound contains a bromomethyl group at the 6-position and a methyl group at the 2-position, contributing to its unique reactivity and potential applications in medicinal chemistry. The presence of the bromomethyl group makes it a versatile intermediate for further chemical modifications, allowing for the synthesis of various derivatives. The dihydro form indicates that the compound has a saturated ring, which can influence its physical properties, such as solubility and stability. Additionally, quinazolinones are known for their biological activity, including potential anti-cancer and anti-inflammatory properties, making this compound of interest in pharmaceutical research. Its molecular structure and functional groups suggest that it may participate in hydrogen bonding and other intermolecular interactions, which can affect its behavior in biological systems. Overall, 6-Bromomethyl-3,4-dihydro-2-methyl-quinazolin-4-one is a compound with significant potential for further exploration in chemical and biological applications.

Formula: C₁₀H₉BrN₂O

InChI: InChI=1/C10H9BrN2O/c1-6-12-9-3-2-7(5-11)4-8(9)10(14)13-6/h2-4H,5H2,1H3,(H,12,13,14)

SMILES: Cc1nc2ccc(cc2c(n1)O)CBr

Synonyms:

• 6-(Bromomethyl)-2-Methyl-4(1H)-Quinazolinone
• 4,6-(Bromomethyl)-2-Methy Quinazolinone
• 6-(Bromomethyl)-2-methyl-4(3H)-quinazolinone
• 6-Bromomethyl-3,4-dihydro-2-methylquinazoline-4-one
• 6-(bromomethyl)-2-methylquinazolin-4(1H)-one
• Levelling agent 102
• 6-BROMOMETHYL-3,4-DIHYDRO-2-METHYL QUINAZOLIN-4-ONE

4(1H)-Quinazolinone, 6-(bromomethyl)-2-methyl-

CAS: 112888-43-4

Formula: C₁₀H₉BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 253.0953

Ref: IN-DA00HCG2

6-(Bromomethyl)-2-methyl-4(3H)-quinazolinone

CAS: 112888-43-4

6-(Bromomethyl)-2-methyl-4(3H)-quinazolinone (6BMQ) is a synthetic molecule that has been designed to mimic the pharmacophores of quinazoline drugs. This compound is hydrolyzed by alkaline hydrolysis and acetylated in acidic conditions. 6BMQ binds to DNA and inhibits DNA synthesis, leading to cell death. It also has anti-cancer activity, which may be due to its ability to hybridize with DNA. 6BMQ is also a chalcone derivative with an acidic hydrolysis product.

Formula: C₁₀H₉BrN₂O

Purity: Min. 95%

Color and Shape: Off-White Powder

Molecular weight: 253.1 g/mol

Ref: 3D-FB19252