CymitQuimica logo

CAS 112892-88-3

:

4-Carboxaldehydebenzocyclobutene

Description:
4-Carboxaldehydebenzocyclobutene, identified by its CAS number 112892-88-3, is an organic compound characterized by a benzocyclobutene structure with a carboxaldehyde functional group at the 4-position. This compound features a fused bicyclic system, which contributes to its unique chemical properties, including potential reactivity due to the presence of the aldehyde group. The carboxaldehyde functional group is known for its ability to undergo various chemical reactions, such as oxidation and condensation, making it a versatile intermediate in organic synthesis. Additionally, the bicyclic nature of benzocyclobutene can influence its physical properties, such as melting and boiling points, as well as its solubility in different solvents. The compound may also exhibit interesting electronic properties due to the conjugation between the aromatic ring and the aldehyde group. Overall, 4-Carboxaldehydebenzocyclobutene is of interest in the fields of organic chemistry and materials science, particularly for applications in polymer synthesis and as a building block for more complex molecules.
Formula:C9H8O
InChI:InChI=1/C9H8O/c10-6-7-1-2-8-3-4-9(8)5-7/h1-2,5-6H,3-4H2
InChI key:OIVKWICRTVJWFO-UHFFFAOYSA-N
SMILES:c1cc2CCc2cc1C=O
Synonyms:
  • Bicyclo[4.2.0]octa-1,3,5-triene-3-carbaldehyde
  • Bicyclo[4.2.0]Octa-1,3,5-Triene-3-Carboxaldehyde
Found 4 products.