CAS 112898-10-9
:2-acetamido-N-(epsilon-aminocaproyl)-*2-deoxy-B-D
Description:
The chemical substance known as "2-acetamido-N-(epsilon-aminocaproyl)-2-deoxy-B-D-glucose" (CAS number 112898-10-9) is a derivative of 2-deoxy-D-glucose, which is a monosaccharide. This compound features an acetamido group and an epsilon-aminocaproyl side chain, which contribute to its unique properties and potential biological activities. The presence of the acetamido group suggests that it may exhibit enhanced solubility and stability compared to its parent sugar. The epsilon-aminocaproyl moiety may impart specific interactions with biological targets, making it of interest in medicinal chemistry and biochemistry. This compound is likely to be polar due to the hydroxyl and amine functionalities, which can influence its solubility in aqueous environments. Additionally, its structural characteristics may allow it to participate in various biochemical pathways, potentially serving as a substrate or inhibitor in enzymatic reactions. Overall, this compound's unique structure positions it as a candidate for further research in drug development and therapeutic applications.
Formula:C14H27N3O6
InChI:InChI=1/C14H27N3O6/c1-8(19)16-11-13(22)12(21)9(7-18)23-14(11)17-10(20)5-3-2-4-6-15/h9,11-14,18,21-22H,2-7,15H2,1H3,(H,16,19)(H,17,20)
SMILES:CC(=NC1C(C(C(CO)OC1N=C(CCCCCN)O)O)O)O
Synonyms:- 2-Acetamido-N-(e-aminocaproyl)-2-deoxy-b-D-glucopyranosylamine
- 2-(acetylamino)-N-(6-aminohexanoyl)-2-deoxyhexopyranosylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Acetamido-N-(e-aminocaproyl)-2-deoxy-b-D-glucopyranosyl amine
CAS:<p>2-Acetamido-N-(e-aminocaproyl)-2-deoxy-b-D-glucopyranosyl amine (Km) is a compound that has been shown to have hexosaminidase activity. It is a human liver enzyme that catalyzes the cleavage of the terminal alpha-1,4 linkage between N-acetylglucosamine and D-glucose residues from the nonreducing end of the beta 1,4 linked N-acetylglucosamine molecule. The KM value for this enzyme is 3.2 mM. This compound also has affinity chromatography properties, which allows it to be used in affinity chromatography experiments as a ligand for concanavalin A. 2KA can be used in gel electrophoresis to separate polypeptides by their size or charge. The corresponding KM value for this process is 22.5 mM. Denaturing conditions are required to</p>Formula:C14H27N3O6Purity:Min. 95%Molecular weight:333.38 g/mol

