CymitQuimica logo

CAS 1129-59-5

:

Benzenepropanenitrile, 3-methoxy-

Description:
Benzenepropanenitrile, 3-methoxy- is an organic compound characterized by its aromatic structure and the presence of both a nitrile group and a methoxy substituent. The compound features a benzene ring attached to a propanenitrile chain, with a methoxy group (-OCH₃) positioned at the meta position relative to the nitrile group. This configuration influences its chemical reactivity and physical properties, such as solubility and boiling point. The presence of the nitrile group contributes to its polarity, making it more soluble in polar solvents. Additionally, the methoxy group can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Benzenepropanenitrile, 3-methoxy- is utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data indicates that, like many nitriles, it should be handled with care due to potential toxicity and irritant properties. Proper storage and handling protocols are essential to mitigate risks associated with exposure.
Formula:C10H11NO
InChI:InChI=1S/C10H11NO/c1-12-10-6-2-4-9(8-10)5-3-7-11/h2,4,6,8H,3,5H2,1H3
InChI key:GJVHYHXGNIMMNO-UHFFFAOYSA-N
SMILES:COC1=CC=CC(=C1)CCC#N
Found 0 products.