CAS 112913-71-0

4-Pyrimidinamine, 2-(trichloromethyl)-

Description:

4-Pyrimidinamine, 2-(trichloromethyl)-, with the CAS number 112913-71-0, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a trichloromethyl group (-CCl3) at the 2-position of the pyrimidine ring significantly influences its reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its trichloromethyl group can participate in various chemical reactions, making it a potential intermediate in organic synthesis. Additionally, compounds with similar structures may exhibit biological activity, including antimicrobial or herbicidal properties, although specific biological data for this compound may vary. Safety data should be consulted, as the presence of chlorine atoms can indicate potential toxicity or environmental hazards. Overall, 4-Pyrimidinamine, 2-(trichloromethyl)- is of interest in both synthetic chemistry and potential applications in pharmaceuticals or agrochemicals.

Formula: C₅H₄Cl₃N₃

InChI: InChI=1S/C5H4Cl3N3/c6-5(7,8)4-10-2-1-3(9)11-4/h1-2H,(H2,9,10,11)

InChI key: InChIKey=UXCSRGSPNUEYBK-UHFFFAOYSA-N

SMILES: C(Cl)(Cl)(Cl)C=1N=C(N)C=CN1

Synonyms:

• 2-(Trichloromethyl)pyrimidin-4-amine
• 4-Amino-2-(trichloromethyl)pyrimidine
• 4-Pyrimidinamine, 2-(trichloromethyl)-