CAS 112914-13-3
:2-Aminomethyl-4-(4-fluorobenzyl)morpholine
Description:
2-Aminomethyl-4-(4-fluorobenzyl)morpholine, with the CAS number 112914-13-3, is a chemical compound characterized by its morpholine structure, which includes an amino group and a fluorobenzyl substituent. This compound typically exhibits properties associated with both amines and morpholines, such as being a potential base and having the ability to form hydrogen bonds due to the presence of the amino group. The fluorobenzyl moiety may influence its lipophilicity and biological activity, making it of interest in medicinal chemistry. The presence of the fluorine atom can enhance the compound's metabolic stability and alter its pharmacokinetic properties. Additionally, the morpholine ring contributes to the compound's overall three-dimensional shape, which can be crucial for interactions with biological targets. As with many organic compounds, its solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and temperature. Overall, this compound may have applications in drug development and research, particularly in fields related to neuropharmacology or medicinal chemistry.
Formula:C12H17FN2O
InChI:InChI=1S/C12H17FN2O/c13-11-3-1-10(2-4-11)8-15-5-6-16-12(7-14)9-15/h1-4,12H,5-9,14H2
InChI key:InChIKey=JHSPPBBJOLKJDH-UHFFFAOYSA-N
SMILES:C(N1CC(CN)OCC1)C2=CC=C(F)C=C2
Synonyms:- (4-(4-Fluorobenzyl)morpholin-2-yl)methanamine
- 1-[4-(4-Fluorobenzyl)Morpholin-2-Yl]Methanamine
- 1-[4-[(4-Fluorophenyl)methyl]morpholin-2-yl]methanamine
- 2-Aminomethyl-4-(4-fluorobenzyl) morpholine
- 2-Morpholinemethanamine, 4-[(4-fluorophenyl)methyl]-
- 4-(4-Fluorobenzyl)morpholin-2-ylmethylamine
- 4-[(4-Fluorophenyl)methyl]-2-morpholinemethanamine
- [4-[(4-Fluorophenyl)methyl]morpholin-2-yl]methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
[4-(4-Fluorobenzyl)morpholin-2-yl]methylamine
CAS:[4-(4-Fluorobenzyl)morpholin-2-yl]methylaminePurity:≥95%Color and Shape:LiquidMolecular weight:224.27g/mol2-Aminomethyl-4-(4-fluorobenzyl)morpholine
CAS:Controlled ProductApplications Mosapride intermediate.
References Kato, S., et al.: Chem. Pharm. Bull., 44, 1484 (1996), Nageswara R., et al.: J. Pharm. Biomed. Anal., 36, 759 (2004),Formula:C12H17FN2OColor and Shape:NeatMolecular weight:224.27[4-(4-Fluorobenzyl)morpholin-2-yl]methylamine
CAS:Formula:C12H17FN2OPurity:98%Color and Shape:LiquidMolecular weight:224.2792-Aminomethyl-4-(4-fluorobenzyl)morpholine
CAS:2-Aminomethyl-4-(4-fluorobenzyl)morpholine (2AMFM) is a prokinetic agent that has been shown to be effective as a treatment for gastrointestinal motility disorders. This drug binds to the 5HT4 receptors, which are found on the enteric nervous system and in the gut. 2AMFM has been shown to increase the frequency of contractions in rat ileum and small intestine preparations. It also increases gastric emptying time and decreases postprandial acidity in dogs. 2AMFM is an enantiomeric mixture of two chiral molecules that are mirror images of each other. The racemic mixture is synthesized by reacting 2-aminomethyl-4-(4-fluorobenzyl)morpholine with chloroacetic acid ethyl ester.Formula:C12H17FN2OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:224.27 g/mol




