CAS 112918-82-8

N-FMOC-IMINODIACETIC ACID

Description:

N-FMOC-imino diacetic acid is a chemical compound characterized by its structure, which includes a fluorinated aromatic group (FMOC) and two carboxylic acid functional groups. The FMOC (9-fluorenylmethoxycarbonyl) group is commonly used in organic synthesis, particularly in peptide chemistry, as a protective group for amines. This compound is typically utilized in the synthesis of various biomolecules and can serve as a chelating agent due to the presence of the imino and carboxylic acid functionalities, allowing it to form stable complexes with metal ions. Its solubility properties are influenced by the presence of the FMOC group, which can enhance its compatibility in organic solvents. Additionally, N-FMOC-imino diacetic acid may exhibit specific reactivity patterns, making it valuable in the development of pharmaceuticals and in research applications involving metal ion coordination. As with many chemical substances, safety precautions should be observed when handling this compound, and it should be stored under appropriate conditions to maintain its stability.

Formula: C₁₉H₁₇NO₆

InChI: InChI=1/C19H17NO6/c21-17(22)9-20(10-18(23)24)19(25)26-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2,(H,21,22)(H,23,24)

SMILES: c1ccc2c(c1)c1ccccc1C2COC(=O)N(CC(=O)O)CC(=O)O

Synonyms:

• 2,2'-{[(9H-fluoren-9-ylmethoxy)carbonyl]imino}diacetic acid
• Fmoc-Ida-OH

Fmoc-iminodiacetic acid

CAS: 112918-82-8

Formula: C₁₉H₁₇NO₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 355.3414

Ref: IN-DA003QNH

N-Fmoc-iminodiacetic acid

CAS: 112918-82-8

Molecular weight: 355.34

Ref: 7W-GM9125

Fmoc-Ida-Oh

CAS: 112918-82-8

Fmoc-Ida-Oh

Purity: 98%

Molecular weight: 355.34g/mol

Ref: 54-OR1013364

Fmoc-iminodiacetic acid

CAS: 112918-82-8

Fmoc-iminodiacetic acid is a versatile building block and reagent that is used in the synthesis of complex compounds, such as peptides, proteins, and pharmaceuticals. It is also a useful intermediate in organic synthesis reactions. Fmoc-iminodiacetic acid has been shown to be effective as a reactant for the preparation of various scaffolds with high purity and quality.

Formula: C₁₉H₁₇NO₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 355.34 g/mol

Ref: 3D-FF49160

Fmoc-iminodiacetic acid

CAS: 112918-82-8

Formula: C₁₉H₁₇NO₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 355.346

Ref: 10-F493066