CAS 112935-94-1
:C,C′-[5-[[(1,1-Dimethylethyl)amino]acetyl]-1,3-phenylene] bis(N,N-dimethylcarbamate)
Description:
C,C′-[5-[[(1,1-Dimethylethyl)amino]acetyl]-1,3-phenylene] bis(N,N-dimethylcarbamate), with CAS number 112935-94-1, is a synthetic organic compound characterized by its complex structure, which includes a phenylene group and two carbamate functional groups. This compound features a tert-butyl group attached to an amino group, contributing to its steric bulk and potentially influencing its reactivity and solubility. The presence of dimethyl carbamate moieties suggests that it may exhibit biological activity, possibly as a pesticide or herbicide, due to the known properties of carbamates in biological systems. Its molecular structure indicates that it may have applications in medicinal chemistry or agrochemicals, although specific biological activities would depend on further empirical studies. Additionally, the compound's stability, solubility in various solvents, and potential interactions with biological targets would be important characteristics to consider in practical applications. Safety data and handling precautions would also be essential for any practical use, given the potential toxicity associated with carbamate derivatives.
Formula:C18H27N3O5
InChI:InChI=1S/C18H27N3O5/c1-18(2,3)19-11-15(22)12-8-13(25-16(23)20(4)5)10-14(9-12)26-17(24)21(6)7/h8-10,19H,11H2,1-7H3
InChI key:InChIKey=TWHUHQNUVSCRPV-UHFFFAOYSA-N
SMILES:C(CNC(C)(C)C)(=O)C1=CC(OC(N(C)C)=O)=CC(OC(N(C)C)=O)=C1
Synonyms:- C,C′-[5-[[(1,1-Dimethylethyl)amino]acetyl]-1,3-phenylene] bis(N,N-dimethylcarbamate)
- Carbamic acid, N,N-dimethyl-, C,C′-[5-[[(1,1-dimethylethyl)amino]acetyl]-1,3-phenylene] ester
- Carbamic acid, dimethyl-, 5-[[(1,1-dimethylethyl)amino]acetyl]-1,3-phenylene ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
