CAS 112946-90-4
:1-[(2S)-2-[5-methoxy-2-(4-{methyl[2-(3,4,5-trimethoxyphenyl)ethyl]amino}butoxy)phenyl]-1,3-benzothiazol-3(2H)-yl]ethanone hydrochloride (1:1)
Description:
1-[(2S)-2-[5-methoxy-2-(4-{methyl[2-(3,4,5-trimethoxyphenyl)ethyl]amino}butoxy)phenyl]-1,3-benzothiazol-3(2H)-yl]ethanone hydrochloride (1:1), with CAS number 112946-90-4, is a complex organic compound characterized by its intricate molecular structure, which includes a benzothiazole moiety, methoxy groups, and an ethanone functional group. This substance is typically classified as a pharmaceutical compound, potentially exhibiting biological activity due to its structural features. The presence of multiple methoxy groups suggests possible interactions with biological targets, enhancing lipophilicity and modulating pharmacokinetic properties. The hydrochloride salt form indicates improved solubility and stability in aqueous environments, which is advantageous for drug formulation. Its stereochemistry, denoted by the (2S) configuration, may influence its biological activity and receptor interactions. Overall, this compound's unique characteristics make it a subject of interest in medicinal chemistry and pharmacology, warranting further investigation into its therapeutic potential and mechanisms of action.
Formula:C32H41ClN2O6S
InChI:InChI=1/C32H40N2O6S.ClH/c1-22(35)34-26-11-7-8-12-30(26)41-32(34)25-21-24(36-3)13-14-27(25)40-18-10-9-16-33(2)17-15-23-19-28(37-4)31(39-6)29(20-23)38-5;/h7-8,11-14,19-21,32H,9-10,15-18H2,1-6H3;1H/t32-;/m0./s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
SA 2572
CAS:SA 2572 is a newly synthesized Ca2+ antagonist having a inhibitory effect on the fast Na+ inward channel.Formula:C32H41ClN2O6SColor and Shape:SolidMolecular weight:617.2
