CAS 1129526-23-3

(2S,2′S)-2,2′-(1,2-Ethanediyl-1,1,2,2-d₄-diimino)bis[1-butan-1,1-d₂-ol]

Description:

The chemical substance known as "(2S,2′S)-2,2′-(1,2-Ethanediyl-1,1,2,2-d4-diimino)bis[1-butan-1,1-d2-ol]" with CAS number 1129526-23-3 is a complex organic compound characterized by its specific stereochemistry and isotopic labeling. The presence of deuterium (d) indicates that certain hydrogen atoms in the molecule are replaced with deuterium, which can influence its physical and chemical properties, such as boiling point and reactivity. The compound features a bis-alcohol structure, suggesting it has two hydroxyl (-OH) groups, which can participate in hydrogen bonding and affect solubility in polar solvents. The imino groups (-NH) contribute to the compound's potential reactivity, particularly in forming coordination complexes or participating in condensation reactions. The stereochemical configuration (2S,2'S) implies that the molecule has specific spatial arrangements that can influence its biological activity and interactions with other molecules. Overall, this compound's unique structure and isotopic composition make it of interest in fields such as medicinal chemistry and materials science.

Formula: C₁₀H₁₆D₈N₂O₂

InChI: InChI=1S/C10H24N2O2/c1-3-9(7-13)11-5-6-12-10(4-2)8-14/h9-14H,3-8H2,1-2H3/t9-,10-/m0/s1/i5D2,6D2,7D2,8D2

InChI key: InChIKey=AEUTYOVWOVBAKS-MKWMBDJFSA-N

SMILES: [C@H](NC(C(N[C@@H](CC)C(O)([2H])[2H])([2H])[2H])([2H])[2H])(CC)C(O)([2H])[2H]

Synonyms:

• 1-Butan-1,1-d2-ol, 2,2′-(1,2-ethanediyl-1,1,2,2-d4-diimino)bis-, (2S,2′S)-
• (2S,2′S)-2,2′-(1,2-Ethanediyl-1,1,2,2-d4-diimino)bis[1-butan-1,1-d2-ol]
• EthaMbutol-d8

Ethambutol-d8

CAS: 1129526-23-3

Formula: C₁₀H₁₆D₈N₂O₂

Color and Shape: White To Off-White Solid

Molecular weight: 212.36

Ref: 4Z-E-274

Ethambutol-d8

CAS: 1129526-23-3

Ethambutol-d8 is a deuterated compound of Ethambutol. Ethambutol has a CAS number of 74-55-5. Ethambutol is a bacteriostatic antimycobacterial agent obstructed the formation of cell wall by inhibiting arabinosyl transferases.

Formula: C₁₀H₁₆D₈N₂O₂

Color and Shape: Solid

Molecular weight: 212.36

Ref: TM-TMIJ-0441