CAS 1129540-65-3

2-Bromo-6-(4-morpholinyl)benzonitrile

Description:

2-Bromo-6-(4-morpholinyl)benzonitrile is an organic compound characterized by its structure, which includes a bromine atom, a morpholine ring, and a nitrile functional group attached to a benzene ring. This compound typically exhibits properties such as being a solid at room temperature, with a specific melting point and solubility characteristics that depend on the solvent used. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The morpholine moiety enhances its biological activity, often making it relevant in medicinal chemistry and drug development. Additionally, the nitrile group can participate in further chemical transformations, allowing for the synthesis of more complex molecules. Overall, 2-Bromo-6-(4-morpholinyl)benzonitrile is of interest in both synthetic organic chemistry and pharmaceutical applications due to its unique structural features and potential reactivity.

Formula: C₁₁H₁₁BrN₂O

InChI: InChI=1S/C11H11BrN2O/c12-10-2-1-3-11(9(10)8-13)14-4-6-15-7-5-14/h1-3H,4-7H2

InChI key: InChIKey=HKIGGSMIIBGCKZ-UHFFFAOYSA-N

SMILES: C(#N)C1=C(C=CC=C1Br)N2CCOCC2

Synonyms:

• 2-Bromo-6-(4-morpholinyl)benzonitrile
• 2-Bromo-6-morpholinobenzonitrile
• Benzonitrile, 2-bromo-6-(4-morpholinyl)-

2-Bromo-6-(4-morpholinyl)benzonitrile, 98%

CAS: 1129540-65-3

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₁₁H₁₁BrN₂O

Purity: 98%

Molecular weight: 267.13

Ref: 02-H61193

2-Bromo-6-morpholinobenzonitrile

CAS: 1129540-65-3

Formula: C₁₁H₁₁BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 267.1218

Ref: IN-DA007RJK

2-Bromo-6-morpholinobenzonitrile

CAS: 1129540-65-3

2-Bromo-6-morpholinobenzonitrile

Purity: 98%

Molecular weight: 267.13g/mol

Ref: 54-OR1062491

2-bromo-6-(morpholin-4-yl)benzonitrile

CAS: 1129540-65-3

Formula: C₁₁H₁₁BrN₂O

Molecular weight: 267.126

Ref: 10-F550755

2-Bromo-6-morpholinobenzonitrile

Controlled Product

CAS: 1129540-65-3

Applications 2-Bromo-6-morpholinobenzonitrile (cas# 1129540-65-3) is a useful research chemical.

Formula: C₁₁H₁₁N₂OBr

Color and Shape: Neat

Molecular weight: 267.12

Ref: TR-B701500