
CAS 112996-51-7
:3-(Pentylamino)butanoic acid
Description:
3-(Pentylamino)butanoic acid, with the CAS number 112996-51-7, is an organic compound characterized by its structure, which includes a butanoic acid backbone with a pentylamino group attached at the third carbon. This compound is classified as an amino acid derivative due to the presence of both an amino group and a carboxylic acid functional group. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the pentyl group contributes to its hydrophobic characteristics, while the carboxylic acid group imparts acidic properties. This compound may exhibit biological activity, potentially influencing neurotransmitter systems or serving as a building block in peptide synthesis. Its solubility in water is moderate, influenced by the length of the alkyl chain, and it may participate in hydrogen bonding due to the carboxylic acid group. As with many amino acid derivatives, it may have applications in pharmaceuticals, biochemistry, and materials science. Safety data should be consulted for handling and storage guidelines.
Formula:C9H19NO2
InChI:InChI=1S/C9H19NO2/c1-3-4-5-6-10-8(2)7-9(11)12/h8,10H,3-7H2,1-2H3,(H,11,12)
InChI key:InChIKey=MDEOHAMDMDUEPS-UHFFFAOYSA-N
SMILES:N(C(CC(O)=O)C)CCCCC
Synonyms:- Butanoic acid, 3-(pentylamino)-
- 3-(Pentylamino)butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.