
CAS 1130-23-0
:Cyclohexaneacetic acid, α-ethyl-1-hydroxy-, sodium salt (1:1)
Description:
Cyclohexaneacetic acid, α-ethyl-1-hydroxy-, sodium salt (1:1), with the CAS number 1130-23-0, is a sodium salt derivative of cyclohexaneacetic acid. This compound typically exhibits characteristics common to carboxylic acid salts, such as being soluble in water due to the presence of the sodium ion, which enhances its ionic nature. The presence of the hydroxy group contributes to its potential as a chelating agent and may influence its reactivity and interaction with biological systems. The α-ethyl substitution on the cyclohexane ring can affect its steric properties and overall molecular conformation, potentially impacting its biological activity and solubility. This compound may be utilized in various applications, including pharmaceuticals and agrochemicals, owing to its functional groups that can participate in chemical reactions or interactions with other molecules. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C10H18O3·Na
InChI:InChI=1S/C10H18O3.Na/c1-2-8(9(11)12)10(13)6-4-3-5-7-10;/h8,13H,2-7H2,1H3,(H,11,12);
InChI key:InChIKey=OGCXPIFRTAYNJF-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CC)C1(O)CCCCC1.[Na]
Synonyms:- Cyclohexaneacetic acid, α-ethyl-1-hydroxy-, sodium salt (1:1)
- Sodium α-ethyl-1-hydroxycyclohexaneacetate
- Cyclobutyrol sodium
- Bilimix
- Cyclohexaneacetic acid, α-ethyl-1-hydroxy-, monosodium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cyclobutyrol sodium salt
CAS:<p>Cyclobutyrol sodium salt is a choleretic agent which also inhibits biliary lipid secretion.</p>Formula:C10H17NaO3Color and Shape:SolidMolecular weight:208.23
