CAS 1130-32-1
:3-Azaspiro[5.5]undecane-2,4-dione
Description:
3-Azaspiro[5.5]undecane-2,4-dione, with the CAS number 1130-32-1, is a bicyclic compound featuring a spiro structure that incorporates a nitrogen atom within its framework. This compound is characterized by its unique spirocyclic arrangement, which contributes to its potential biological activity and chemical reactivity. The presence of two carbonyl groups (diones) in the structure enhances its reactivity, making it a candidate for various chemical transformations. Typically, compounds of this nature may exhibit interesting pharmacological properties, including potential use in medicinal chemistry. The nitrogen atom in the spiro structure can influence the compound's basicity and solubility, affecting its interactions with biological systems. Additionally, the overall rigidity of the spirocyclic framework can impact the compound's conformational stability and reactivity. While specific applications and biological activities may vary, the structural features of 3-Azaspiro[5.5]undecane-2,4-dione suggest it could be of interest in the development of new therapeutic agents or as a building block in organic synthesis.
Formula:C10H15NO2
InChI:InChI=1S/C10H15NO2/c12-8-6-10(7-9(13)11-8)4-2-1-3-5-10/h1-7H2,(H,11,12,13)
InChI key:InChIKey=FNIPRNMPSXNBDI-UHFFFAOYSA-N
SMILES:O=C1CC2(CC(=O)N1)CCCCC2
Synonyms:- 1,1-Cyclohexanediacetimide
- 2,4-Dioxo-3-azaspiro[5.5]undecane
- 3,3-Cyclopentane glutarimide
- 3,3-Pentamethylene glutarimide
- 3,3-Pentamethyleneglutarimide
- 3-Azaspiro[5.5]Undecane-2,4-Dione
- CAI
- NSC 400093
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3,3-Pentamethylene Glutarimide
CAS:Formula:C10H15NO2Purity:97%Color and Shape:SolidMolecular weight:181.2316Gabapentin Impurity 3
CAS:Formula:C10H15NO2Color and Shape:White To Off-White SolidMolecular weight:181.243,3-Pentamethylene glutarimide
CAS:3,3-Pentamethylene glutarimideFormula:C10H15NO2Purity:98%Color and Shape: white to off-white solidMolecular weight:181.23g/mol3,3-Pentamethylene Glutarimide
CAS:Controlled ProductApplications Gabapentin intermediate.
References Leonardi, A., et al.: J. Med. Chem., 47, 1900 (2004),Formula:C10H15NO2Color and Shape:NeatMolecular weight:181.233,3-Pentamethylene glutarimide
CAS:Formula:C10H15NO2Purity:95%Color and Shape:SolidMolecular weight:181.2353,3-Pentamethylene glutarimide
CAS:3,3-Pentamethylene glutarimide is an amide that can be used for the synthesis of gabapentin. It is synthesized from cyclohexanone and hydrochloric acid in a reaction that utilizes ammonium salt as a catalyst. 3,3-Pentamethylene glutarimide reacts with deionized water to form the monamide product. The filtrate is collected and concentrated before it is cooled to produce gabapentin.
Formula:C10H15NO2Purity:Min. 95%Molecular weight:181.23 g/mol







