CymitQuimica logo

CAS 113021-30-0

:

2-Iodo-1-indanone

Description:
2-Iodo-1-indanone is an organic compound characterized by its indanone structure, which consists of a fused benzene and cyclopentanone ring system. The presence of an iodine atom at the second position of the indanone framework significantly influences its chemical reactivity and properties. This compound typically appears as a solid and is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The iodo substituent can facilitate various reactions, such as nucleophilic substitutions and coupling reactions, making it a valuable intermediate in synthetic chemistry. Additionally, 2-Iodo-1-indanone may exhibit unique spectroscopic properties, allowing for its identification and characterization through techniques like NMR and IR spectroscopy. Its reactivity and functionalization potential make it a subject of interest in research focused on developing new materials and compounds with specific biological activities. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C9H7IO
InChI:InChI=1/C9H7IO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8H,5H2
SMILES:c1ccc2c(c1)CC(C2=O)I
Synonyms:
  • 2,3-Dihydro-2-iodo-1H-inden-1-one
  • 2-Iodoindanone
  • 2-iodo-2,3-dihydro-1H-inden-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.