CAS 113028-78-7

1-(2-fluoro-6-methoxyphenyl)piperazine

Description:

1-(2-Fluoro-6-methoxyphenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 2-fluoro-6-methoxyphenyl group indicates that the compound has a fluorine atom and a methoxy group (-OCH3) attached to a phenyl ring, specifically at the 2 and 6 positions, respectively. This substitution pattern can influence the compound's pharmacological properties, potentially affecting its interaction with biological targets. The compound is often studied for its potential applications in medicinal chemistry, particularly in the development of psychoactive agents or as a scaffold for drug design. Its molecular structure suggests it may exhibit properties such as lipophilicity, which can influence its bioavailability and ability to cross biological membranes. Additionally, the presence of the piperazine moiety is commonly associated with various pharmacological activities, including anxiolytic and antidepressant effects. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₅FN₂O

InChI: InChI=1/C11H15FN2O/c1-15-10-4-2-3-9(12)11(10)14-7-5-13-6-8-14/h2-4,13H,5-8H2,1H3

SMILES: COc1cccc(c1N1CCNCC1)F

Synonyms:

• Phloroglucinol Impurity 75
• Piperazine, 1-(2-fluoro-6-methoxyphenyl)-
• 1-(2-fluoro-6-Methoxyphenyl)piperazine

1-(2-Fluoro-6-methoxyphenyl)piperazine

Controlled Product

CAS: 113028-78-7

Versatile small molecule scaffold

Formula: C₁₁H₁₅FN₂O

Purity: Min. 95%

Molecular weight: 210.25 g/mol

Ref: 3D-NEA02878