CymitQuimica logo

CAS 1130489-20-1

:

1-[[4-(1,1-Dimethylethyl)phenyl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trimethylsilyl)-1H-1,2,3-triazole

Description:
The chemical substance known as 1-[[4-(1,1-Dimethylethyl)phenyl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trimethylsilyl)-1H-1,2,3-triazole, with CAS number 1130489-20-1, is a complex organic compound characterized by its unique structural features. It contains a triazole ring, which is a five-membered heterocyclic compound with three nitrogen atoms, contributing to its potential reactivity and biological activity. The presence of a boron-containing moiety, specifically a dioxaborolane, suggests potential applications in organic synthesis and materials science, particularly in the development of boron-based catalysts or ligands. Additionally, the incorporation of trimethylsilyl groups enhances its stability and solubility in organic solvents, making it suitable for various chemical reactions. The bulky tert-butyl and tetramethyl groups may also influence its steric properties, potentially affecting its interactions in biological systems or catalytic processes. Overall, this compound exemplifies the intricate design often found in modern organic chemistry, with implications for both synthetic and applied chemistry.
Formula:C22H36BN3O2Si
InChI:InChI=1S/C22H36BN3O2Si/c1-20(2,3)17-13-11-16(12-14-17)15-26-18(19(24-25-26)29(8,9)10)23-27-21(4,5)22(6,7)28-23/h11-14H,15H2,1-10H3
InChI key:InChIKey=HPLHPSGDKFREDL-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C1=C(N(CC2=CC=C(C(C)(C)C)C=C2)N=N1)B3OC(C)(C)C(C)(C)O3
Synonyms:
  • 1-[[4-(1,1-Dimethylethyl)phenyl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trimethylsilyl)-1H-1,2,3-triazole
  • 1H-1,2,3-Triazole, 1-[[4-(1,1-dimethylethyl)phenyl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trimethylsilyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.