CymitQuimica logo

CAS 113066-25-4

:

6-(2-chlorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide

Description:
6-(2-Chlorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide is a chemical compound that belongs to the class of benzodiazepines, which are known for their psychoactive properties. This particular compound features a fused imidazole and benzodiazepine structure, contributing to its potential biological activity. The presence of a 2-chlorophenyl group enhances its lipophilicity, which may influence its pharmacokinetic properties, such as absorption and distribution in biological systems. The carboxamide functional group is likely to play a role in its interaction with biological targets, potentially affecting its binding affinity and selectivity. This compound may exhibit various pharmacological effects, including anxiolytic, sedative, or anticonvulsant activities, although specific biological data would be necessary to confirm these effects. As with many benzodiazepines, the compound's safety profile, therapeutic index, and potential side effects would be critical considerations in its application. Overall, this compound represents a unique structure within the benzodiazepine family, warranting further investigation for its medicinal properties.
Formula:C18H13ClN4O
InChI:InChI=1/C18H13ClN4O/c19-13-7-3-1-5-11(13)16-12-6-2-4-8-14(12)23-10-22-17(18(20)24)15(23)9-21-16/h1-8,10H,9H2,(H2,20,24)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.