CymitQuimica logo

CAS 113082-39-6

:

2-Chloro-6-methylquinazoline

Description:
2-Chloro-6-methylquinazoline is a heterocyclic organic compound characterized by a quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the second position and a methyl group at the sixth position of the quinazoline ring significantly influences its chemical properties and reactivity. This compound is typically a crystalline solid and may exhibit moderate solubility in organic solvents. It is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. The chlorine substituent can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. Additionally, 2-chloro-6-methylquinazoline can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, 2-chloro-6-methylquinazoline is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H7ClN2
InChI:InChI=1S/C9H7ClN2/c1-6-2-3-8-7(4-6)5-11-9(10)12-8/h2-5H,1H3
InChI key:InChIKey=BLRNCALGXJQCJP-UHFFFAOYSA-N
SMILES:CC1=CC2=C(N=C(Cl)N=C2)C=C1
Synonyms:
  • 2-Chloro-6-methylquinazoline
  • Quinazoline, 2-chloro-6-methyl-
Found 4 products.