CAS 1131-17-5
:5-Chloro-3-methyl-1-phenylpyrazole
Description:
5-Chloro-3-methyl-1-phenylpyrazole is an organic compound belonging to the pyrazole class of heterocyclic compounds. It features a pyrazole ring substituted with a chlorine atom at the 5-position and a methyl group at the 3-position, along with a phenyl group at the 1-position. This compound is characterized by its relatively low molecular weight and specific structural features that contribute to its chemical reactivity and potential applications. It is often utilized in agricultural chemistry as a pesticide or herbicide due to its ability to inhibit certain biological processes in target organisms. The presence of the chlorine atom enhances its lipophilicity, which can influence its bioavailability and environmental persistence. Additionally, the compound may exhibit various physical properties such as solubility in organic solvents and stability under specific conditions. Safety and handling precautions are essential when working with this substance, as it may pose health risks if not managed properly. Overall, 5-Chloro-3-methyl-1-phenylpyrazole is a significant compound in both research and practical applications within the field of chemistry.
Formula:C10H9ClN2
InChI:InChI=1/C10H9ClN2/c1-8-7-10(11)13(12-8)9-5-3-2-4-6-9/h2-7H,1H3
InChI key:InChIKey=ZZOWFLAMMWOSCG-UHFFFAOYSA-N
SMILES:ClC=1N(N=C(C)C1)C2=CC=CC=C2
Synonyms:- 1H-Pyrazole, 5-chloro-3-methyl-1-phenyl-
- 5-chloro-3-methyl-1-phenyl-1H-pyrazole
- Pyrazole, 5-chloro-3-methyl-1-phenyl-
- 5-Chloro-3-methyl-1-phenylpyrazole
- AKOS B029727
- BUTTPARK 48\06-20
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Chloro-3-methyl-1-phenyl-1H-pyrazole, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H9ClN2Purity:98%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:192.655-Chloro-3-Methyl-1-Phenyl-1H-Pyrazole
CAS:Formula:C10H9ClN2Purity:97%Color and Shape:SolidMolecular weight:192.64495-Chloro-3-methyl-1-phenylpyrazole
CAS:<p>5-Chloro-3-methyl-1-phenylpyrazole</p>Purity:98%Color and Shape:LiquidMolecular weight:192.64g/mol5-chloro-3-methyl-1-phenyl-1H-pyrazole
CAS:Formula:C10H9ClN2Purity:95%Color and Shape:LiquidMolecular weight:192.65




