CAS 1131-33-5

2-PHENYLPYRIDINE 1-OXIDE

Description:

2-Phenylpyridine 1-oxide, with the CAS number 1131-33-5, is an organic compound characterized by its pyridine ring substituted with a phenyl group and an oxide functional group. This compound typically appears as a pale yellow to brown liquid or solid, depending on its purity and form. It is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the nitrogen atom in the pyridine ring imparts basicity, while the oxide group can participate in various chemical reactions, including oxidation and coordination with metal ions. 2-Phenylpyridine 1-oxide is often utilized in organic synthesis and as a ligand in coordination chemistry due to its ability to form complexes with transition metals. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility in organic solvents and moderate volatility are also notable characteristics, influencing its applications in various chemical processes. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₁H₉NO

InChI: InChI=1/C11H9NO/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H

SMILES: c1ccc(cc1)c1ccccn1=O

Synonyms:

• 2-Phenylpyridine N-Oxide

2-Phenylpyridine 1-Oxide

CAS: 1131-33-5

Formula: C₁₁H₉NO

Purity: >98.0%(T)(HPLC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 171.20

Ref: 3B-P2775

2-Phenylpyridine 1-Oxide

CAS: 1131-33-5

Formula: C₁₁H₉NO

Purity: %

Color and Shape: Solid

Molecular weight: 171.1953

Ref: IN-DA008XVF

2-Phenylpyridine 1-Oxide

CAS: 1131-33-5

2-Phenylpyridine 1-Oxide

Purity: 98%

Molecular weight: 171.20g/mol

Ref: 54-OR72426

2-Phenyl-pyridine 1-oxide, 95%

CAS: 1131-33-5

Formula: C₁₁H₉NO

Purity: 95%

Color and Shape: White Solid

Molecular weight: 171.20

Ref: 08-07-0254