CAS 1131-40-4
:2-Bromo-1,3,5-trimethoxybenzene
Description:
2-Bromo-1,3,5-trimethoxybenzene, with the CAS number 1131-40-4, is an organic compound characterized by its bromine and methoxy substituents on a benzene ring. This compound features a bromine atom at the second position and three methoxy groups (-OCH3) at the 1, 3, and 5 positions of the aromatic ring, which significantly influence its chemical properties and reactivity. The presence of methoxy groups enhances the electron density of the benzene ring, making it more nucleophilic and reactive in electrophilic substitution reactions. Additionally, the bromine atom serves as a good leaving group, facilitating further chemical transformations. 2-Bromo-1,3,5-trimethoxybenzene is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure makes it of interest in various fields, including organic synthesis and medicinal chemistry, where it may serve as a precursor for more complex molecules or as a potential bioactive compound. Safety precautions should be taken when handling this substance, as with many halogenated organic compounds.
Formula:C9H11BrO3
InChI:InChI=1S/C9H11BrO3/c1-11-6-4-7(12-2)9(10)8(5-6)13-3/h4-5H,1-3H3
InChI key:InChIKey=BPWYNWSOQOXOPI-UHFFFAOYSA-N
SMILES:O(C)C1=C(Br)C(OC)=CC(OC)=C1
Synonyms:- 1-Bromo-2,4,6-trimethoxybenzene
- 2,4,6-Trimethoxy-1-bromobenzene
- 4-Bromo-1,3,5-trimethoxybenzene
- Benzene, 2-bromo-1,3,5-trimethoxy-
- Bromophloroglucinol trimethyl ether
- Nsc 151970
- 2-Bromo-1,3,5-trimethoxybenzene
- 2-Bromo-1,3,5-trimethoxybenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Bromo-2,4,6-trimethoxybenzene
CAS:Formula:C9H11BrO3Purity:95%Color and Shape:SolidMolecular weight:247.08582-Bromo-1,3,5-trimethoxybenzene
CAS:Formula:C9H11BrO3Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:247.092-Bromo-1,3,5-trimethoxybenzene
CAS:2-Bromo-1,3,5-trimethoxybenzeneFormula:C9H11BrO3Purity:98%Color and Shape: white solidMolecular weight:247.09g/mol1-Bromo-2,4,6-trimethoxybenzene
CAS:<p>1-Bromo-2,4,6-trimethoxybenzene is a reactive chemical that has shown to have toxic properties in model studies. It reacts with metals such as Iridium and can be used to remove halogens from solutions. It is also able to react with a variety of other molecules, including peroxides, chlorine gas and bromine gas. 1-Bromo-2,4,6-trimethoxybenzene can form free radicals when exposed to UV radiation and may be used as a ligand for metal ions. 1-Bromo-2,4,6-trimethoxybenzene is also soluble in n-dimethylformamide and carbon tetrachloride.</p>Formula:C9H11BrO3Purity:Min. 95%Color and Shape:White PowderMolecular weight:247.09 g/mol1-Bromo-2,4,6-trimethoxybenzene
CAS:Formula:C9H11BrO3Purity:95%Color and Shape:Crystalline PowderMolecular weight:247.088





