CAS 113100-53-1: 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Description:1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a methyl group at the 1-position and a trifluoromethyl group at the 3-position contributes to its unique properties, including increased lipophilicity and potential biological activity. The carboxylic acid functional group at the 4-position enhances its acidity and reactivity, making it useful in various chemical reactions and applications. This compound is often studied for its potential as a pharmaceutical intermediate or agrochemical, given the influence of the trifluoromethyl group on biological activity. Its molecular structure allows for various interactions, including hydrogen bonding and dipole-dipole interactions, which can affect its solubility and stability in different environments. Overall, 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a versatile compound with significant implications in medicinal chemistry and material science.
Formula:C6H5F3N2O2
InChI:InChI=1S/C6H5F3N2O2/c1-11-2-3(5(12)13)4(10-11)6(7,8)9/h2H,1H3,(H,12,13)
InChI key:InChIKey=FZNKJQNEJGXCJH-UHFFFAOYSA-N
SMILES:O=C(O)C1=CN(N=C1C(F)(F)F)C
- Synonyms:
- 1-Methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid
- 1-Methyl-3-Trifluoromethylpyrazole-4-Carboxylic Acid
- 1H-Pyrazole-4-carboxylic acid, 1-methyl-3-(trifluoromethyl)-
- 3-(Trifluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
- Buttpark 99\18-24
- 1-Methyl-3-trifluoromethyl-4-pyrazolecarboxylic Acid
- 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

1-Methyl-3-(trifluoromethyl)pyrazole-4-carboxylic Acid
Ref: 3B-M2628
1g | 63.00 € |

1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Ref: IN-DA003EHO
1g | 25.00 € | ||
5g | 33.00 € | ||
10g | 50.00 € | ||
25g | 93.00 € | ||
100g | 155.00 € | ||
250mg | 21.00 € |

1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Ref: 54-PC9458
1g | 32.00 € |

1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Ref: FT-CAPOM11116
1g | To inquire | ||
5g | To inquire |

1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Ref: 10-F010145
5g | 20.00 € | ||
10g | 31.00 € | ||
25g | 68.00 € | ||
100g | 129.00 € |

3-(Trifluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic Acid
Controlled ProductRef: TR-T791365
10g | 683.00 € | ||
25g | 1,289.00 € | ||
2500mg | 230.00 € |

3-(Trifluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
Ref: 3D-FT57042
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |