CAS 113111-32-3
:1-(4-Methylphenyl)-1,2-cyclopropanedicarboxylic acid
Description:
1-(4-Methylphenyl)-1,2-cyclopropanedicarboxylic acid, with the CAS number 113111-32-3, is an organic compound characterized by its unique cyclopropane structure fused with a dicarboxylic acid functional group and a para-methylphenyl substituent. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, though its solubility in water is limited due to the hydrophobic nature of the aromatic ring. The presence of carboxylic acid groups contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its structural features may impart interesting biological activities, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the steric effects of the methyl group on the aromatic ring, which may affect its interactions in biological systems or synthetic applications. Overall, this compound represents a valuable building block in organic synthesis and pharmaceutical development.
Formula:C12H12O4
InChI:InChI=1S/C12H12O4/c1-7-2-4-8(5-3-7)12(11(15)16)6-9(12)10(13)14/h2-5,9H,6H2,1H3,(H,13,14)(H,15,16)
InChI key:InChIKey=RIDXNPOAOROPNF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(C(C(O)=O)C1)C2=CC=C(C)C=C2
Synonyms:- 1-(4-Methylphenyl)-1,2-cyclopropanedicarboxylic acid
- 1,2-Cyclopropanedicarboxylic acid, 1-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
