CAS 1131121-64-6

5-Bromo-3-methyl-1-(phenylmethyl)-1H-pyrazolo[3,4-b]pyridine

Description:

5-Bromo-3-methyl-1-(phenylmethyl)-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both bromine and methyl groups. This compound features a bromine atom at the 5-position and a methyl group at the 3-position of the pyrazolo ring, along with a phenylmethyl substituent at the 1-position. The presence of these functional groups contributes to its potential biological activity and makes it of interest in medicinal chemistry. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic phenyl group, which can influence its solubility and permeability in biological systems. Additionally, the bromine atom may impart unique reactivity and stability characteristics, making it a candidate for further chemical modifications. Its specific applications may include roles in drug development or as a research tool in studying pyrazolo-pyridine derivatives. As with many heterocycles, the compound's reactivity and interactions can be influenced by the electronic effects of the substituents present.

Formula: C₁₄H₁₂BrN₃

InChI: InChI=1S/C14H12BrN3/c1-10-13-7-12(15)8-16-14(13)18(17-10)9-11-5-3-2-4-6-11/h2-8H,9H2,1H3

InChI key: InChIKey=VRYQSNURSDBYEX-UHFFFAOYSA-N

SMILES: C(N1C=2C(C(C)=N1)=CC(Br)=CN2)C3=CC=CC=C3

Synonyms:

• 5-Bromo-3-methyl-1-(phenylmethyl)-1H-pyrazolo[3,4-b]pyridine
• 1-Benzyl-5-bromo-3-methyl-1H-pyrazolo[3,4-b]pyridine
• 1H-Pyrazolo[3,4-b]pyridine, 5-bromo-3-methyl-1-(phenylmethyl)-