CAS 113118-81-3
:5-Bromo-3-Formylpyridine
Description:
5-Bromo-3-formylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a formyl group (-CHO) at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a yellow to brown solid and is soluble in organic solvents such as dichloromethane and ethanol. Its structure allows for various chemical transformations, making it useful in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. The formyl group can participate in nucleophilic addition reactions, while the bromine atom can serve as a leaving group in substitution reactions. Additionally, 5-bromo-3-formylpyridine may exhibit biological activity, which can be explored in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C6H4BrNO
InChI:InChI=1/C6H4BrNO/c7-6-1-5(4-9)2-8-3-6/h1-4H
SMILES:c1c(cncc1Br)C=O
Synonyms:- Chembrdg-Bb 4011095
- Aurora Ka-3030
- 3-Bromopyridine-5-Carbaldehyde
- 3-Bromopyridine-5-Carboxaldehyde
- 5-Bromo-PYRIDINE-3-Carbaldehyde
- 5-Bromo-3-pyridinecarboxaldehyde
- 5-Bromopyridine-3-carboxaldehyde
- 5-Bromonicotinaldehyde
- 3-Bromo-5-pyridinecarboxaldehyde
- 5-Bromo-3-pyridinecarboxyaldehyde
- 5-Bromonicotimaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5-Bromopyridine-3-carboxaldehyde, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H4BrNOPurity:97%Molecular weight:186.015-Bromopyridine-3-Carboxaldehyde
CAS:Formula:C6H4BrNOPurity:96%Color and Shape:SolidMolecular weight:186.00615-Bromo-3-pyridinecarboxaldehyde
CAS:Formula:C6H4BrNOPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:186.015-Bromonicotinaldehyde
CAS:5-BromonicotinaldehydeFormula:C6H4BrNOPurity:97%Color and Shape: pale lemon powderMolecular weight:186.01g/mol







