CAS 113118-84-6

5-Phenyl-3-pyridinecarboxaldehyde

Description:

5-Phenyl-3-pyridinecarboxaldehyde, with the CAS number 113118-84-6, is an organic compound characterized by its pyridine and aldehyde functional groups. It features a pyridine ring substituted with a phenyl group and an aldehyde group at the 3 and 5 positions, respectively. This compound typically appears as a yellow to brown solid or liquid, depending on its purity and specific conditions. It is known for its aromatic properties, which contribute to its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of both the pyridine and aldehyde functionalities allows for various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, 5-Phenyl-3-pyridinecarboxaldehyde may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₂H₉NO

InChI: InChI=1S/C12H9NO/c14-9-10-6-12(8-13-7-10)11-4-2-1-3-5-11/h1-9H

InChI key: InChIKey=ACFVOZGSDCHVGJ-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(=CN=C1)C2=CC=CC=C2

Synonyms:

• 5-Phenyl-3-pyridinecarboxaldehyde
• 3-Pyridinecarboxaldehyde, 5-phenyl-

3-​Pyridinecarboxaldehy​de, 5-​phenyl-

CAS: 113118-84-6

Formula: C₁₂H₉NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 183.2060

Ref: IN-DA008XX5

5-Phenylnicotinaldehyde

CAS: 113118-84-6

Formula: C₁₂H₉NO

Purity: 97%

Molecular weight: 183.21

Ref: 10-F327180