CAS 113121-36-1

3-Amino-6-(propylthio)pyridazine

Description:

3-Amino-6-(propylthio)pyridazine is a heterocyclic organic compound characterized by the presence of a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The compound features an amino group (-NH2) at the 3-position and a propylthio group (-S-CH2-CH2-CH3) at the 6-position, contributing to its unique chemical properties. This structure imparts both basic and nucleophilic characteristics to the molecule, making it potentially reactive in various chemical reactions. The presence of the propylthio group enhances its lipophilicity, which may influence its solubility and biological activity. 3-Amino-6-(propylthio)pyridazine may be of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Additionally, its synthesis and reactivity can be explored in the context of developing new materials or as intermediates in organic synthesis. As with many organic compounds, safety and handling precautions should be observed when working with this substance.

Formula: C₇H₁₁N₃S

InChI: InChI=1/C7H11N3S/c1-2-5-11-7-4-3-6(8)9-10-7/h3-4H,2,5H2,1H3,(H2,8,9)

SMILES: CCCSc1ccc(=N)[nH]n1

Synonyms:

• 3-Pyridazinamine, 6-(Propylthio)-
• 6-(Propylsulfanyl)-3-pyridazinamine
• 6-(Propylsulfanyl)pyridazin-3-amin
• 6-(Propylsulfanyl)pyridazin-3-amine