
CAS 1131220-40-0
:4-(1,1-Dimethylethyl) (2S)-2-(4-carboxyphenyl)-4-morpholinecarboxylate
Description:
4-(1,1-Dimethylethyl) (2S)-2-(4-carboxyphenyl)-4-morpholinecarboxylate is a chemical compound characterized by its complex structure, which includes a morpholine ring and carboxylic acid functionalities. This compound features a tert-butyl group, which contributes to its hydrophobic characteristics, and a carboxyphenyl moiety that enhances its potential for interactions in biological systems. The presence of the morpholine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to mimic natural compounds and interact with biological targets. The stereochemistry indicated by the (2S) designation implies specific spatial arrangements that can influence the compound's reactivity and biological activity. Additionally, the carboxylate group may facilitate solubility in polar solvents and enhance the compound's reactivity in various chemical reactions. Overall, this compound's unique structural features position it as a candidate for further research in drug development and other chemical applications.
Formula:C16H21NO5
InChI:InChI=1S/C16H21NO5/c1-16(2,3)22-15(20)17-8-9-21-13(10-17)11-4-6-12(7-5-11)14(18)19/h4-7,13H,8-10H2,1-3H3,(H,18,19)/t13-/m1/s1
InChI key:InChIKey=BWLHTRAQVOVRCJ-CYBMUJFWSA-N
SMILES:C(OC(C)(C)C)(=O)N1C[C@@H](OCC1)C2=CC=C(C(O)=O)C=C2
Synonyms:- 4-Morpholinecarboxylic acid, 2-(4-carboxyphenyl)-, 4-(1,1-dimethylethyl) ester, (2S)-
- 4-(1,1-Dimethylethyl) (2S)-2-(4-carboxyphenyl)-4-morpholinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Morpholinecarboxylic acid, 2-(4-carboxyphenyl)-, 4-(1,1-dimethylethyl) ester, (2S)-
CAS:Formula:C16H21NO5Molecular weight:307.3416
