CAS 1131222-53-1
:5-Bromo-3,4-dihydro-2-(2-propen-1-yl)-1(2H)-isoquinolinone
Description:
5-Bromo-3,4-dihydro-2-(2-propen-1-yl)-1(2H)-isoquinolinone is a chemical compound characterized by its isoquinolinone structure, which features a fused bicyclic system. The presence of a bromine atom at the 5-position contributes to its reactivity and potential applications in medicinal chemistry. The compound also contains a propenyl group at the 2-position, which can influence its biological activity and interactions with other molecules. Its dihydro form indicates that it has two hydrogen atoms added to the aromatic system, affecting its stability and reactivity. This compound may exhibit various pharmacological properties, making it of interest in drug development and research. Additionally, its unique structural features may allow for specific interactions with biological targets, potentially leading to therapeutic applications. As with many organic compounds, its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, 5-Bromo-3,4-dihydro-2-(2-propen-1-yl)-1(2H)-isoquinolinone represents a versatile structure in organic and medicinal chemistry.
Formula:C12H12BrNO
InChI:InChI=1S/C12H12BrNO/c1-2-7-14-8-6-9-10(12(14)15)4-3-5-11(9)13/h2-5H,1,6-8H2
InChI key:InChIKey=PJBUVUFVNIVPOO-UHFFFAOYSA-N
SMILES:O=C1C=2C(=C(Br)C=CC2)CCN1CC=C
Synonyms:- 5-Bromo-3,4-dihydro-2-(2-propen-1-yl)-1(2H)-isoquinolinone
- 1(2H)-Isoquinolinone, 5-bromo-3,4-dihydro-2-(2-propen-1-yl)-
- 2-Allyl-5-bromo-3,4-dihydroisoquinolin-1(2H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
