CAS 1131335-49-3
:2,6-Diiodo-3,5-dimethoxypyridine
Description:
2,6-Diiodo-3,5-dimethoxypyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with two iodine atoms and two methoxy groups. The iodine substituents are located at the 2 and 6 positions of the pyridine ring, while the methoxy groups are positioned at the 3 and 5 positions. This compound is notable for its potential applications in medicinal chemistry and material science due to the reactivity of the iodine atoms, which can participate in various chemical reactions, including nucleophilic substitutions. The methoxy groups enhance the solubility and stability of the compound, making it suitable for various synthetic pathways. Additionally, the presence of halogens and methoxy groups can influence the electronic properties of the molecule, affecting its reactivity and interaction with biological targets. Overall, 2,6-Diiodo-3,5-dimethoxypyridine is a versatile compound with significant implications in research and development within organic chemistry.
Formula:C7H7I2NO2
InChI:InChI=1S/C7H7I2NO2/c1-11-4-3-5(12-2)7(9)10-6(4)8/h3H,1-2H3
InChI key:InChIKey=HEJVCFGXTPOHNW-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(OC)C(I)=NC1I
Synonyms:- Pyridine, 2,6-diiodo-3,5-dimethoxy-
- 2,6-Diiodo-3,5-dimethoxypyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
