CymitQuimica logo

CAS 1131335-54-0

:

2,3-Dimethoxy-6-(trimethylsilyl)pyridine

Description:
2,3-Dimethoxy-6-(trimethylsilyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two methoxy groups (-OCH3) at the 2 and 3 positions enhances its electron-donating properties, potentially increasing its reactivity in electrophilic substitution reactions. The trimethylsilyl group (-Si(CH3)3) at the 6 position serves as a protecting group for the nitrogen atom, which can influence the compound's solubility and stability. This compound is typically colorless to pale yellow and may exhibit moderate volatility due to the presence of the trimethylsilyl group. It is soluble in organic solvents such as dichloromethane and ether, but its solubility in water is limited. 2,3-Dimethoxy-6-(trimethylsilyl)pyridine is often utilized in organic synthesis, particularly in reactions involving nucleophilic substitution or as a ligand in coordination chemistry. Its unique structural features make it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals.
Formula:C10H17NO2Si
InChI:InChI=1S/C10H17NO2Si/c1-12-8-6-7-9(14(3,4)5)11-10(8)13-2/h6-7H,1-5H3
InChI key:InChIKey=YEWXSCYFBZMKQZ-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=CC([Si](C)(C)C)=N1
Synonyms:
  • Pyridine, 2,3-dimethoxy-6-(trimethylsilyl)-
  • 2,3-Dimethoxy-6-(trimethylsilyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.