CAS 1131335-66-4

6-Bromofuro[3,2-b]pyridine-2-methanol

Description:

6-Bromofuro[3,2-b]pyridine-2-methanol is a heterocyclic organic compound characterized by the presence of both a bromine atom and a furo[3,2-b]pyridine moiety. This compound features a fused ring system that combines a pyridine and a furan, contributing to its unique chemical properties. The presence of the hydroxymethyl group (-CH2OH) at the 2-position enhances its reactivity, making it a potential candidate for various chemical transformations. The bromine substituent at the 6-position can serve as a site for nucleophilic substitution reactions, which is valuable in synthetic chemistry. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and conditions, and it may participate in hydrogen bonding due to the hydroxyl group. Overall, 6-Bromofuro[3,2-b]pyridine-2-methanol is a versatile compound with potential applications in organic synthesis and pharmacology.

Formula: C₈H₆BrNO₂

InChI: InChI=1S/C8H6BrNO2/c9-5-1-8-7(10-3-5)2-6(4-11)12-8/h1-3,11H,4H2

InChI key: InChIKey=ZRGSQDAFELBQJZ-UHFFFAOYSA-N

SMILES: C(O)C1=CC=2C(O1)=CC(Br)=CN2

(6-Bromofuro[3,2-b]pyridin-2-yl)methanol

CAS: 1131335-66-4

Formula: C₈H₆BrNO₂

Molecular weight: 228.0427

Ref: IN-DA009M2T

(6-Bromofuro[3,2-b]pyridin-2-yl)methanol

CAS: 1131335-66-4

Versatile small molecule scaffold

Formula: C₈H₆BrNO₂

Purity: Min. 95%

Molecular weight: 228.04 g/mol

Ref: 3D-GVB33566