CymitQuimica logo

CAS 1131335-68-6

:

6-Iodofuro[3,2-b]pyridine

Description:
6-Iodofuro[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and furan rings, with an iodine substituent at the 6-position of the pyridine ring. This compound typically exhibits properties associated with both aromatic and heteroaromatic systems, including stability and potential reactivity due to the presence of the iodine atom, which can participate in various chemical reactions such as nucleophilic substitutions or coupling reactions. The presence of the iodine atom also influences the compound's electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, 6-Iodofuro[3,2-b]pyridine may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its solubility and stability in various solvents can vary, depending on the specific conditions and the presence of functional groups. Overall, this compound represents a valuable scaffold for further chemical modifications and applications in synthetic organic chemistry and pharmacology.
Formula:C7H4INO
InChI:InChI=1S/C7H4INO/c8-5-3-7-6(9-4-5)1-2-10-7/h1-4H
InChI key:InChIKey=CWYHCZNHNCLALA-UHFFFAOYSA-N
SMILES:IC=1C=C2C(=NC1)C=CO2
Synonyms:
  • Furo[3,2-b]pyridine, 6-iodo-
  • 6-Iodofuro[3,2-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.