CAS 1131335-72-2

6-Bromo-2-(trimethylsilyl)furo[3,2-b]pyridine

Description:

6-Bromo-2-(trimethylsilyl)furo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique structure, which combines a furo[3,2-b]pyridine framework with a bromine substituent and a trimethylsilyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions and coupling reactions. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, facilitating its use in synthetic applications. This compound is typically utilized in medicinal chemistry and materials science due to its interesting electronic properties and potential biological activity. Its synthesis often involves multi-step processes, including halogenation and silylation reactions. As with many organobromine compounds, it is essential to handle 6-Bromo-2-(trimethylsilyl)furo[3,2-b]pyridine with care, considering the potential hazards associated with brominated compounds. Overall, its unique structural features and functional groups make it a valuable compound in various research fields.

Formula: C₁₀H₁₂BrNOSi

InChI: InChI=1S/C10H12BrNOSi/c1-14(2,3)10-5-8-9(13-10)4-7(11)6-12-8/h4-6H,1-3H3

InChI key: InChIKey=IXYOZGPZWPDQKP-UHFFFAOYSA-N

SMILES: [Si](C)(C)(C)C1=CC=2C(O1)=CC(Br)=CN2

Synonyms:

• Furo[3,2-b]pyridine, 6-bromo-2-(trimethylsilyl)-
• 6-Bromo-2-(trimethylsilyl)furo[3,2-b]pyridine
• (6-Bromofuro[3,2-b]pyridin-2-yl)-trimethylsilane

6-Bromo-2-(trimethylsilyl)furo[3,2-b]pyridine

CAS: 1131335-72-2

Formula: C₁₀H₁₂BrNOSi

Purity: 98%

Molecular weight: 270.1979

Ref: IN-DA0090RT

6-Bromo-2-(trimethylsilyl)furo[3,2-b]pyridine

CAS: 1131335-72-2

Purity: 97%

Molecular weight: 270.2009888

Ref: 10-F763859