CAS 113137-29-4
:N-(4-chloro-2-methoxyphenyl)-2,2-dimethylpropanamide
Description:
N-(4-chloro-2-methoxyphenyl)-2,2-dimethylpropanamide, with the CAS number 113137-29-4, is a chemical compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a 4-chloro-2-methoxyphenyl group, indicating the presence of a chlorine atom and a methoxy group on a phenyl ring, contributing to its unique chemical properties and potential biological activity. The 2,2-dimethylpropanamide portion of the molecule suggests steric hindrance due to the presence of two methyl groups on the carbon adjacent to the amide nitrogen, which can influence its reactivity and interactions with biological targets. The compound may exhibit specific solubility characteristics, stability under various conditions, and potential applications in pharmaceuticals or agrochemicals, depending on its biological activity. As with many organic compounds, its properties can be influenced by factors such as temperature, pH, and the presence of other chemical species.
Formula:C12H16ClNO2
InChI:InChI=1/C12H16ClNO2/c1-12(2,3)11(15)14-9-6-5-8(13)7-10(9)16-4/h5-7H,1-4H3,(H,14,15)
SMILES:CC(C)(C)C(=Nc1ccc(cc1OC)Cl)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-(4-Chloro-6-methoxyphenyl)-2,2-dimethylpropanamide
CAS:Formula:C12H16ClNO2Color and Shape:SolidMolecular weight:241.7139N-(4-Chloro-6-methoxyphenyl)-2,2-dimethylpropanamide
CAS:Controlled ProductApplications N-(4-Chloro-6-methoxyphenyl)-2,2-dimethylpropanamide (cas# 113137-29-4) is a compound useful in organic synthesis.
Formula:C12H16ClNO2Color and Shape:Brown To Dark BrownMolecular weight:241.71

