CAS 113146-74-0: 1,17:2,6-Dimethano-8H-naphtho[1,2-f]furo[3,4-b:2,3-c']bisoxocin-4,8,11,19(1H,8aH)-tetrone,2,3,6,6a,9,10,10a,10b,12,16,16a,17-dodecahydro-8a,16,17-trihydroxy-2,3,6a,10b-tetramethyl-,(1S,2S,3S,6R,6aS,8aR,10aS,10bR,16R,16aS,17R,18aR)-
Description:The chemical substance known as 1,17:2,6-Dimethano-8H-naphtho[1,2-f]furo[3,4-b:2,3-c']bisoxocin-4,8,11,19(1H,8aH)-tetrone is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple fused rings and functional groups. It features a tetrone moiety, indicating the presence of four carbonyl groups, and is further modified with hydroxyl groups, contributing to its potential reactivity and solubility in various solvents. The stereochemistry of the molecule is defined by multiple chiral centers, which can influence its biological activity and interactions with other molecules. This compound is likely to exhibit significant pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 113146-74-0, allows for precise identification in chemical databases. Overall, the structural complexity and functional diversity of this compound suggest potential applications in drug development and materials science, although specific biological or chemical properties would require further investigation.
Formula:C28H32O10
InChI:InChI=1S/C28H32O10/c1-12-21(32)36-17-11-23(12,2)19-20(31)27(35)18-14(24(3)13(10-15(18)29)6-5-7-16(24)30)8-9-26(34)22(33)37-25(17,4)28(19,26)38-27/h5-6,10,12,14-15,17-19,29,34-35H,7-9,11H2,1-4H3/t12-,14+,15-,17-,18+,19+,23-,24+,25+,26+,27-,28+/m1/s1
InChI key:InChIKey=CUSXWWXXAPEFHY-HRLARMCRSA-N
SMILES:O=C1OC2CC(C)(C1C)C3C(=O)C4(O)OC35C(O)(C(=O)OC25C)CCC6C4C(O)C=C7C=CCC(=O)C76C
- Synonyms:
- (-)-Physalin L
- (1S,2S,3S,6R,6aS,8aR,10aS,10bR,16R,16aS,17R,18aR)-2,3,6,6a,9,10,10a,10b,12,16,16a,17-Dodecahydro-8a,16,17-trihydroxy-2,3,6a,10b-tetramethyl-1,17:2,6-dimethano-8H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,19(1H,8aH)-tetrone
- 1,17:2,6-Dimethano-8H-naphtho[1,2-f]furo[3,4-b:2,3-c']bisoxocin-4,8,11,19(1H,8aH)-tetrone,2,3,6,6a,9,10,10a,10b,12,16,16a,17-dodecahydro-8a,16,17-trihydroxy-2,3,6a,10b-tetramethyl-,[1S-(1a,2b,3b,6b,6aa,8aa,10aa,10bb,16a,16ab,17b,18aS*)]-
- 16,24-Cyclo-13,14-secoergosta-3,5-diene-18,26-dioic acid, 14,17-epoxy-7,13,14,20,22-pentahydroxy-1,15-dioxo-, γ-lactone δ-lactone, (7α,14α,16β,22α,25S)-
- 16,24-Cyclo-13,14-secoergosta-3,5-diene-18,26-dioicacid, 14,17-epoxy-7,13,14,20,22-pentahydroxy-1,15-dioxo-, g-lactone d-lactone, (7a,14a,16b,22a,25S)-
- 1,17:2,6-Dimethano-8H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,19(1H,8aH)-tetrone, 2,3,6,6a,9,10,10a,10b,12,16,16a,17-dodecahydro-8a,16,17-trihydroxy-2,3,6a,10b-tetramethyl-, (1S,2S,3S,6R,6aS,8aR,10aS,10bR,16R,16aS,17R,18aR)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Physalin L REF: TM-TN1102CAS: 113146-74-0 | 98% | 147.00 €~693.00 € | Mon 28 Apr 25 |
![]() | Physalin L REF: BP-BP1091CAS: 113146-74-0 | 95%~99% | To inquire | Wed 30 Apr 25 |
![]() | Physalin L REF: 3D-FP73973CAS: 113146-74-0 | Min. 95% | - - - | Discontinued product |

Physalin L
Ref: TM-TN1102
1mg | 147.00 € | ||
5mg | 693.00 € |

Physalin L
Ref: 3D-FP73973
1mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information |