CAS 113158-51-3: O-α-<span class="text-smallcaps">D</smallcap>-Glucopyranosyl-(1→4)-O-α-<smallcap>D</smallcap>-glucopyranosyl-(1→4)-<smallcap>D</span>-glucopyranose
Description:O-α-D-Glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-D-glucopyranose, commonly referred to as a type of oligosaccharide, is a carbohydrate composed of multiple glucose units linked by glycosidic bonds. This compound features a repeating structure of glucose molecules, specifically linked through α(1→4) glycosidic linkages, which is characteristic of certain polysaccharides. It is soluble in water, reflecting the hydrophilic nature of its glucose units. The presence of multiple hydroxyl groups contributes to its solubility and reactivity, allowing it to participate in various biochemical processes. This oligosaccharide may exhibit prebiotic properties, promoting the growth of beneficial gut bacteria. Additionally, it can serve as a substrate for specific enzymes, influencing its digestibility and metabolic pathways. Its structural complexity and biological significance make it a subject of interest in both food science and nutrition. The CAS number 113158-51-3 uniquely identifies this compound, facilitating its recognition in scientific literature and databases.
Formula:C18H32O16
InChI:InChI=1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16?,17-,18-/m1/s1
InChI key:InChIKey=FYGDTMLNYKFZSV-DZOUCCHMSA-N
SMILES:OCC1OC(OC2C(O)C(O)C(OC2CO)OC3C(O)C(O)C(O)OC3CO)C(O)C(O)C1O
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Maltotriose (Mixture of Diastereomers) REF: 4Z-M-250008CAS: 113158-51-3 | - - - | To inquire | Thu 10 Apr 25 |
![]() | Maltotriose (Mixture of Diastereomers) REF: 4Z-L-092004CAS: | - - - | - - - | Discontinued product |
![]() | o-α-D-Glucopyranosyl-(1→4)-o-α-D-glucopyranosyl-(1→4)-D-glucopyranose REF: 3D-NEA15851CAS: 113158-51-3 | Min. 95% | - - - | Discontinued product |

Ref: 4Z-M-250008
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

Maltotriose (Mixture of Diastereomers)
Ref: 4Z-L-092004
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |

o-α-D-Glucopyranosyl-(1→4)-o-α-D-glucopyranosyl-(1→4)-D-glucopyranose
Ref: 3D-NEA15851
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |