
CAS 1131587-18-2
:Methyl 5-iodo-2-[(2-methylpropyl)amino]benzoate
Description:
Methyl 5-iodo-2-[(2-methylpropyl)amino]benzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety substituted with an iodine atom and an alkylamino group. The presence of the iodine atom enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The 2-methylpropylamino group contributes to its basicity and can influence its solubility in different solvents. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its ability to participate in further chemical transformations. Its molecular structure suggests it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. Safety data should be consulted, as iodine-containing compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings. Overall, Methyl 5-iodo-2-[(2-methylpropyl)amino]benzoate represents a versatile building block in organic synthesis.
Formula:C12H16INO2
InChI:InChI=1S/C12H16INO2/c1-8(2)7-14-11-5-4-9(13)6-10(11)12(15)16-3/h4-6,8,14H,7H2,1-3H3
InChI key:InChIKey=KUFBCOYJBSIHPP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(NCC(C)C)C=CC(I)=C1
Synonyms:- Benzoic acid, 5-iodo-2-[(2-methylpropyl)amino]-, methyl ester
- Methyl 5-iodo-2-[(2-methylpropyl)amino]benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
