CAS 1131587-25-1
:Methyl 2-ethyl-5-iodobenzoate
Description:
Methyl 2-ethyl-5-iodobenzoate is an organic compound characterized by its ester functional group, specifically a methyl ester derived from benzoic acid. It features a benzene ring substituted with an ethyl group at the 2-position and an iodine atom at the 5-position, which influences its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the iodine atom can enhance its reactivity in nucleophilic substitution reactions, making it useful in various synthetic applications in organic chemistry. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, Methyl 2-ethyl-5-iodobenzoate is a valuable compound in both synthetic organic chemistry and potential medicinal applications.
Formula:C10H11IO2
InChI:InChI=1S/C10H11IO2/c1-3-7-4-5-8(11)6-9(7)10(12)13-2/h4-6H,3H2,1-2H3
InChI key:InChIKey=NBNASQGNMNMJGF-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(CC)C=CC(I)=C1
Synonyms:- Methyl 2-ethyl-5-iodobenzoate
- Benzoic acid, 2-ethyl-5-iodo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
