CAS 1131587-40-0
:Methyl 5-iodo-2-(1-piperidinylmethyl)benzoate
Description:
Methyl 5-iodo-2-(1-piperidinylmethyl)benzoate is a chemical compound characterized by its structural features, which include a benzoate moiety substituted with an iodine atom and a piperidinylmethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the iodine atom can enhance the compound's electrophilic character, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The piperidine ring introduces basicity and can participate in hydrogen bonding, influencing the compound's solubility and biological activity. Methyl 5-iodo-2-(1-piperidinylmethyl)benzoate may also exhibit specific pharmacological properties, making it of interest in drug development. Its molecular structure suggests potential applications in the synthesis of more complex molecules, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed due to its chemical nature and potential biological effects.
Formula:C14H18INO2
InChI:InChI=1S/C14H18INO2/c1-18-14(17)13-9-12(15)6-5-11(13)10-16-7-3-2-4-8-16/h5-6,9H,2-4,7-8,10H2,1H3
InChI key:InChIKey=IZTUEHPMTZFENM-UHFFFAOYSA-N
SMILES:C(C1=C(C(OC)=O)C=C(I)C=C1)N2CCCCC2
Synonyms:- Methyl 5-iodo-2-(1-piperidinylmethyl)benzoate
- Benzoic acid, 5-iodo-2-(1-piperidinylmethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
