CymitQuimica logo

CAS 1131587-46-6

:

Methyl 2-hydroxy-5-iodo-4-methoxybenzoate

Description:
Methyl 2-hydroxy-5-iodo-4-methoxybenzoate, identified by its CAS number 1131587-46-6, is an organic compound that belongs to the class of benzoate esters. This substance features a benzoic acid derivative structure, characterized by the presence of a methoxy group (-OCH3) and a hydroxyl group (-OH) on the aromatic ring, along with an iodine atom at the 5-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The methoxy group typically enhances lipophilicity, while the hydroxyl group can participate in hydrogen bonding, influencing solubility and reactivity. Additionally, the iodine substituent may impart unique properties, such as increased molecular weight and potential for biological activity. Overall, Methyl 2-hydroxy-5-iodo-4-methoxybenzoate is a compound of interest for further research due to its structural features and potential applications in synthetic chemistry.
Formula:C9H9IO4
InChI:InChI=1S/C9H9IO4/c1-13-8-4-7(11)5(3-6(8)10)9(12)14-2/h3-4,11H,1-2H3
InChI key:InChIKey=RAEQPXDBTUQMET-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(O)C=C(OC)C(I)=C1
Synonyms:
  • Benzoic acid, 2-hydroxy-5-iodo-4-methoxy-, methyl ester
  • Methyl 2-hydroxy-5-iodo-4-methoxybenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.