CAS 1131587-47-7
:Ethyl 5-iodo-2,4-dimethylbenzoate
Description:
Ethyl 5-iodo-2,4-dimethylbenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. This compound features a benzene ring substituted with two methyl groups at the 2 and 4 positions, and an iodine atom at the 5 position, contributing to its unique reactivity and properties. The presence of the iodine atom can enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Ethyl 5-iodo-2,4-dimethylbenzoate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it suitable for applications in organic synthesis and medicinal chemistry. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. As with many halogenated compounds, safety precautions should be taken when handling it due to potential toxicity and environmental concerns.
Formula:C11H13IO2
InChI:InChI=1S/C11H13IO2/c1-4-14-11(13)9-6-10(12)8(3)5-7(9)2/h5-6H,4H2,1-3H3
InChI key:InChIKey=FLZCCFKUNNZOTA-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(C)C=C(C)C(I)=C1
Synonyms:- Benzoic acid, 5-iodo-2,4-dimethyl-, ethyl ester
- Ethyl 5-iodo-2,4-dimethylbenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
