CAS 1131587-48-8
:Methyl 2-hydroxy-5-iodo-4-(trifluoromethyl)benzoate
Description:
Methyl 2-hydroxy-5-iodo-4-(trifluoromethyl)benzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety substituted with a hydroxyl group, an iodine atom, and a trifluoromethyl group. The presence of the hydroxyl group contributes to its potential as a phenolic compound, which may exhibit various chemical reactivities, including hydrogen bonding and nucleophilicity. The iodine substituent can enhance the compound's reactivity in electrophilic aromatic substitution reactions, while the trifluoromethyl group is known for imparting unique electronic properties, often increasing lipophilicity and altering the compound's biological activity. This compound may be of interest in pharmaceutical chemistry and materials science due to its potential applications in drug development and as a building block in organic synthesis. Its molecular structure suggests that it may exhibit interesting physical properties, such as solubility in organic solvents and specific melting or boiling points, which are important for practical applications. Safety and handling precautions should be observed due to the presence of iodine and fluorinated groups, which can pose health and environmental risks.
Formula:C9H6F3IO3
InChI:InChI=1S/C9H6F3IO3/c1-16-8(15)4-2-6(13)5(3-7(4)14)9(10,11)12/h2-3,14H,1H3
InChI key:InChIKey=RKMFBGVZSJDQRC-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(I)C=C(C(OC)=O)C(O)=C1
Synonyms:- Methyl 2-hydroxy-5-iodo-4-(trifluoromethyl)benzoate
- Benzoic acid, 2-hydroxy-5-iodo-4-(trifluoromethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
