CAS 1131587-49-9
:Ethyl 5-iodo-2,4-dimethoxybenzoate
Description:
Ethyl 5-iodo-2,4-dimethoxybenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a benzene ring substituted with two methoxy groups at the 2 and 4 positions, and an iodine atom at the 5 position, contributing to its unique reactivity and properties. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various synthetic applications. This compound is typically a solid or liquid at room temperature, depending on its purity and specific formulation. Its iodine substituent can facilitate nucleophilic substitution reactions, making it valuable in organic synthesis, particularly in the preparation of more complex molecules. Additionally, the methoxy groups can influence the electronic properties of the molecule, affecting its reactivity and interaction with other chemical species. As with many halogenated compounds, safety precautions should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C11H13IO4
InChI:InChI=1S/C11H13IO4/c1-4-16-11(13)7-5-8(12)10(15-3)6-9(7)14-2/h5-6H,4H2,1-3H3
InChI key:InChIKey=YUATYDAPORMTIQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(OC)C=C(OC)C(I)=C1
Synonyms:- Benzoic acid, 5-iodo-2,4-dimethoxy-, ethyl ester
- Ethyl 5-iodo-2,4-dimethoxybenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
